|
CAS#: 7509-98-0 Product: 2,7-Dimethylnaphthalene, 2,4,6-Trinitrobenzene-1,3-Diol No suppilers available for the product. |
| Name | 2,7-Dimethylnaphthalene, 2,4,6-Trinitrobenzene-1,3-Diol |
|---|---|
| Synonyms | 2,7-Dimethylnaphthalene; 2,4,6-Trinitroresorcinol; Nsc406004 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15N3O8 |
| Molecular Weight | 401.33 |
| CAS Registry Number | 7509-98-0 |
| SMILES | C1=C([N+]([O-])=O)C(=C([N+]([O-])=O)C(=C1[N+]([O-])=O)O)O.C2=C(C=CC3=C2C=C(C=C3)C)C |
| InChI | 1S/C12H12.C6H3N3O8/c1-9-3-5-11-6-4-10(2)8-12(11)7-9;10-5-2(7(12)13)1-3(8(14)15)6(11)4(5)9(16)17/h3-8H,1-2H3;1,10-11H |
| InChIKey | FSJWEYWFUCZIMB-UHFFFAOYSA-N |
| Boiling point | 292.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 126.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Dimethylnaphthalene, 2,4,6-Trinitrobenzene-1,3-Diol |