|
CAS#: 7515-73-3 Product: 4-(Chlorophenylmethyl)-1,1'-Biphenyl No suppilers available for the product. |
| Name | 4-(Chlorophenylmethyl)-1,1'-Biphenyl |
|---|---|
| Synonyms | 1-(Chloro-Phenyl-Methyl)-4-Phenyl-Benzene; 4-(Chlorophenylmethyl)-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15Cl |
| Molecular Weight | 278.78 |
| CAS Registry Number | 7515-73-3 |
| EINECS | 231-369-8 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2)C(C3=CC=CC=C3)Cl |
| InChI | 1S/C19H15Cl/c20-19(17-9-5-2-6-10-17)18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14,19H |
| InChIKey | HSVIAUJGCMPSQO-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.562°C at 760 mmHg (Cal.) |
| Flash point | 191.379°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(Chlorophenylmethyl)-1,1'-Biphenyl |