Online Database of Chemicals from Around the World
|
CAS#: 75150-13-9 Product: 2-[(2,4-Dibromo-6-Methylphenoxy)Methyl]Oxirane No suppilers available for the product. |
| Name | 2-[(2,4-Dibromo-6-Methylphenoxy)Methyl]Oxirane |
|---|---|
| Synonyms | 2-[(2,4-Dibromo-6-Methyl-Phenoxy)Methyl]Oxirane; ((2,4-Dibromo-6-Methylphenoxy)Methyl)Oxirane; 2,4-Dibromo-6-Methylphenyl Glycidyl Ether |
| Molecular Structure | ![CAS#: 75150-13-9, 2-[(2,4-Dibromo-6-Methylphenoxy)Methyl]Oxirane](/moreStructures/75150-13-9.gif) |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 322.00 |
| CAS Registry Number | 75150-13-9 |
| EINECS | 278-084-5 |
| SMILES | C1=C(C=C(C(=C1C)OCC2CO2)Br)Br |
| InChI | 1S/C10H10Br2O2/c1-6-2-7(11)3-9(12)10(6)14-5-8-4-13-8/h2-3,8H,4-5H2,1H3 |
| InChIKey | XQTJZNGNEJLXTR-UHFFFAOYSA-N |
| Density | 1.765g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.638°C at 760 mmHg (Cal.) |
| Flash point | 143.828°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2,4-Dibromo-6-Methylphenoxy)Methyl]Oxirane |