|
CAS#: 7527-94-8 Product: Alkofanone No suppilers available for the product. |
| Name | Alkofanone |
|---|---|
| Synonyms | Alkofanone; 1-Propanone, 3-((4-Aminophenyl)Sulfonyl)-1,3-Diphenyl- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 |
| CAS Registry Number | 7527-94-8 |
| SMILES | C1=CC(=CC=C1N)[S](=O)(=O)C(CC(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C21H19NO3S/c22-18-11-13-19(14-12-18)26(24,25)21(17-9-5-2-6-10-17)15-20(23)16-7-3-1-4-8-16/h1-14,21H,15,22H2 |
| InChIKey | VWEMSUCCUQSLME-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 628.668°C at 760 mmHg (Cal.) |
| Flash point | 334.007°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Alkofanone |