|
CAS#: 75351-10-9 Product: (3-Dimethylamino-1,2,4-Thiadiazol-5-Yl)-(1H-Indol-3-Yl)Methanone No suppilers available for the product. |
| Name | (3-Dimethylamino-1,2,4-Thiadiazol-5-Yl)-(1H-Indol-3-Yl)Methanone |
|---|---|
| Synonyms | Methanone, (3-(Dimethylamino)-1,2,4-Thiadiazol-5-Yl)-1H-Indol-3-Yl-; Dendrodoine; Methanone, 5-[3-(N,N-Dimethylamino-1,2,4-Thiazolyl]- 3-Indolyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.32 |
| CAS Registry Number | 75351-10-9 |
| SMILES | C3=C(C(C1=NC(=NS1)N(C)C)=O)C2=C(C=CC=C2)[NH]3 |
| InChI | 1S/C13H12N4OS/c1-17(2)13-15-12(19-16-13)11(18)9-7-14-10-6-4-3-5-8(9)10/h3-7,14H,1-2H3 |
| InChIKey | XXIZLPNTFMKYIO-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.96°C at 760 mmHg (Cal.) |
| Flash point | 253.143°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3-Dimethylamino-1,2,4-Thiadiazol-5-Yl)-(1H-Indol-3-Yl)Methanone |