|
CAS#: 75413-10-4 Product: Ethyl 3-Oxopyrrolizine-2-Carboxylate No suppilers available for the product. |
| Name | Ethyl 3-Oxopyrrolizine-2-Carboxylate |
|---|---|
| Synonyms | 3-Oxo-2-Pyrrolizinecarboxylic Acid Ethyl Ester; 3-Ketopyrrolizine-2-Carboxylic Acid Ethyl Ester; Nsc81372 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 |
| CAS Registry Number | 75413-10-4 |
| SMILES | C2=C1[N](C(=O)C(=C1)C(=O)OCC)C=C2 |
| InChI | 1S/C10H9NO3/c1-2-14-10(13)8-6-7-4-3-5-11(7)9(8)12/h3-6H,2H2,1H3 |
| InChIKey | GATNRQBLVUYTRL-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.158°C at 760 mmHg (Cal.) |
| Flash point | 111.14°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-Oxopyrrolizine-2-Carboxylate |