|
CAS#: 75420-34-7 Product: (3H)-Saxitoxinol No suppilers available for the product. |
| Name | (3H)-Saxitoxinol |
|---|---|
| Synonyms | (3As-(3Aalpha,4Alpha,10Beta,10Ar*))-2,6-Amino-3A,4,9,10-Tetrahydro-10-Hydroxy-1H,8H-Pyrrolo(1,2-C)Purine-4-Methanol Alpha-Carbamate; 1H,8H-Pyrrolo(1,2-C)Purine-4-Methanol, 2,6-Amino-3A,4,9,10-Tetrahydro-10-Hydroxy-, Alpha-Carbamate, (3As-(3Aalpha,4Alpha,10Beta,10Ar*))-; Dihydrosaxitoxin |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17N7O3 |
| Molecular Weight | 283.29 |
| CAS Registry Number | 75420-34-7 |
| SMILES | [C@@H]13NC(=NC12N(CC[C@H]2O)C(=N[C@H]3COC(=O)N)N)N |
| InChI | 1S/C10H17N7O3/c11-7-15-6-4(3-20-9(13)19)14-8(12)17-2-1-5(18)10(6,17)16-7/h4-6,18H,1-3H2,(H2,12,14)(H2,13,19)(H3,11,15,16)/t4-,5+,6-,10?/m0/s1 |
| InChIKey | NILHUXIFTLLDPJ-TXDDJGQJSA-N |
| Density | 2.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 638.913°C at 760 mmHg (Cal.) |
| Flash point | 340.203°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3H)-Saxitoxinol |