|
CAS#: 75456-21-2 Product: 3,9-Dihydroxyoctahydrodibenzo(a,g)Biphenylene No suppilers available for the product. |
| Name | 3,9-Dihydroxyoctahydrodibenzo(a,g)Biphenylene |
|---|---|
| Synonyms | Dhohdbbp; Dibenzo(A,G)Biphenylene-3,9-Diol, 5,6,6A,6B,11,12,12A,12B-Octahydro-, (6Aalpha,6Bbeta,12Abeta,12Balpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 |
| CAS Registry Number | 75456-21-2 |
| SMILES | C5=C4C1C(C2C1CCC3=CC(=CC=C23)O)CCC4=CC(=C5)O |
| InChI | 1S/C20H20O2/c21-13-3-7-15-11(9-13)1-5-17-19(15)18-6-2-12-10-14(22)4-8-16(12)20(17)18/h3-4,7-10,17-22H,1-2,5-6H2 |
| InChIKey | OOYXVGFWIONADE-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.547°C at 760 mmHg (Cal.) |
| Flash point | 253.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,9-Dihydroxyoctahydrodibenzo(a,g)Biphenylene |