|
CAS#: 75463-61-5 Product: N-Ethyl-1,2,3,5,6,7-Hexahydro-S-Indacen-1-Amine Hydrochloride No suppilers available for the product. |
| Name | N-Ethyl-1,2,3,5,6,7-Hexahydro-S-Indacen-1-Amine Hydrochloride |
|---|---|
| Synonyms | Ethyl-(1,2,3,5,6,7-Hexahydro-S-Indacen-1-Yl)Amine Hydrochloride; 1,2,3,5,6,7-Hexahydro-N-Ethyl-S-Indacen-1-Amine Hydrochloride; Vufb10,104 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 |
| CAS Registry Number | 75463-61-5 |
| SMILES | [H+].C1=C3C(=CC2=C1C(NCC)CC2)CCC3.[Cl-] |
| InChI | 1S/C14H19N.ClH/c1-2-15-14-7-6-12-8-10-4-3-5-11(10)9-13(12)14;/h8-9,14-15H,2-7H2,1H3;1H |
| InChIKey | PUUIAARVFVGILC-UHFFFAOYSA-N |
| Boiling point | 325.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 157.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-1,2,3,5,6,7-Hexahydro-S-Indacen-1-Amine Hydrochloride |