Online Database of Chemicals from Around the World
|
CAS#: 7564-07-0 Product: N-Desmethyl-N(4)-Desoxychlordiazepoxide No suppilers available for the product. |
| Name | N-Desmethyl-N(4)-Desoxychlordiazepoxide |
|---|---|
| Synonyms | (7-Chloro-5-Phenyl-3H-1,4-Benzodiazepin-2-Yl)Amine; 3H-1,4-Benzodiazepin-2-Amine, 7-Chloro-5-Phenyl-; Desmethyldesoxychlordiazepoxide |
| Molecular Structure |  |
| Molecular Formula | C15H12ClN3 |
| Molecular Weight | 269.73 |
| CAS Registry Number | 7564-07-0 |
| SMILES | C2=C1C(=NCC(=NC1=CC=C2Cl)N)C3=CC=CC=C3 |
| InChI | 1S/C15H12ClN3/c16-11-6-7-13-12(8-11)15(18-9-14(17)19-13)10-4-2-1-3-5-10/h1-8H,9H2,(H2,17,19) |
| InChIKey | UMBZDAJGYNJMGS-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.21°C at 760 mmHg (Cal.) |
| Flash point | 226.684°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Desmethyl-N(4)-Desoxychlordiazepoxide |