|
CAS#: 75680-27-2 Product: Niveusinc No suppilers available for the product. |
| Name | Niveusinc |
|---|---|
| Synonyms | Niveusin C |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 |
| CAS Registry Number | 75680-27-2 |
| SMILES | [C@@H]12[C@@H](C[C@]3(O[C@](\C(=C/[C@H]1OC(C2=C)=O)C)(O)C[C@@H]3O)C)OC(C(=C\C)/C)=O |
| InChI | 1S/C20H26O7/c1-6-10(2)17(22)26-14-8-19(5)15(21)9-20(24,27-19)11(3)7-13-16(14)12(4)18(23)25-13/h6-7,13-16,21,24H,4,8-9H2,1-3,5H3/b10-6-,11-7-/t13-,14-,15+,16+,19-,20-/m1/s1 |
| InChIKey | WGVJNQGTZSPMCY-BZHZVRAUSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 574.47°C at 760 mmHg (Cal.) |
| Flash point | 201.703°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Niveusinc |