|
CAS#: 75784-65-5 Product: Tert-Butyl 4-Dimethylaminobenzoate No suppilers available for the product. |
| Name | Tert-Butyl 4-Dimethylaminobenzoate |
|---|---|
| Synonyms | 4-Dimethylaminobenzoic Acid Tert-Butyl Ester; Tert-Butyl P-(Dimethylamino)Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 |
| CAS Registry Number | 75784-65-5 |
| EINECS | 278-310-2 |
| SMILES | C1=C(N(C)C)C=CC(=C1)C(OC(C)(C)C)=O |
| InChI | 1S/C13H19NO2/c1-13(2,3)16-12(15)10-6-8-11(9-7-10)14(4)5/h6-9H,1-5H3 |
| InChIKey | VIENHFOQVALVRD-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.523°C at 760 mmHg (Cal.) |
| Flash point | 112.951°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl 4-Dimethylaminobenzoate |