|
CAS#: 75808-54-7 Product: (2S)-2-(Dithiocarboxyamino)Pentanedioic Acid No suppilers available for the product. |
| Name | (2S)-2-(Dithiocarboxyamino)Pentanedioic Acid |
|---|---|
| Synonyms | (2S)-2-(Dithiocarboxyamino)Glutaric Acid; L-N-(Dithiocarboxy)Glutamic Acid Trisodium Salt; Glutamic Acid, N-(Dithiocarboxy)-, L-, Trisodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9NO4S2 |
| Molecular Weight | 223.26 |
| CAS Registry Number | 75808-54-7 |
| SMILES | [C@H](C(=O)O)(NC(=S)S)CCC(=O)O |
| InChI | 1S/C6H9NO4S2/c8-4(9)2-1-3(5(10)11)7-6(12)13/h3H,1-2H2,(H,8,9)(H,10,11)(H2,7,12,13)/t3-/m0/s1 |
| InChIKey | SAOZKHJCFQSMFB-VKHMYHEASA-N |
| Density | 1.539g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.598°C at 760 mmHg (Cal.) |
| Flash point | 207.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-(Dithiocarboxyamino)Pentanedioic Acid |