|
CAS#: 75852-56-1 Product: 2-[3-(4-Chlorophenyl)Phenyl]Propanoic Acid No suppilers available for the product. |
| Name | 2-[3-(4-Chlorophenyl)Phenyl]Propanoic Acid |
|---|---|
| Synonyms | 2-[3-(4-Chlorophenyl)Phenyl]Propionic Acid; 3-Biphenylacetic Acid, 4'-Chloro-Alpha-Methyl-; 4'-Chloro-Alpha-Methyl-3-Biphenylacetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 |
| CAS Registry Number | 75852-56-1 |
| SMILES | C1=C(C=CC=C1C2=CC=C(C=C2)Cl)C(C(O)=O)C |
| InChI | 1S/C15H13ClO2/c1-10(15(17)18)12-3-2-4-13(9-12)11-5-7-14(16)8-6-11/h2-10H,1H3,(H,17,18) |
| InChIKey | OAHCVJGEJQPWCP-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.651°C at 760 mmHg (Cal.) |
| Flash point | 208.203°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[3-(4-Chlorophenyl)Phenyl]Propanoic Acid |