|
CAS#: 75935-42-1 Product: N-Butyl-N'-(4-Chlorophenyl)-8-Hydroxynaphthalene-1,6-Disulfonamide No suppilers available for the product. |
| Name | N-Butyl-N'-(4-Chlorophenyl)-8-Hydroxynaphthalene-1,6-Disulfonamide |
|---|---|
| Synonyms | N-Butyl-N'-(4-Chlorophenyl)-8-Hydroxy-Naphthalene-1,6-Disulfonamide; N1-Butyl-N6-(4-Chlorophenyl)-8-Hydroxynaphthalene-1,6-Disulphonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21ClN2O5S2 |
| Molecular Weight | 468.97 |
| CAS Registry Number | 75935-42-1 |
| EINECS | 278-347-4 |
| SMILES | C2=C([S](=O)(=O)NC1=CC=C(Cl)C=C1)C=C(O)C3=C2C=CC=C3[S](=O)(=O)NCCCC |
| InChI | 1S/C20H21ClN2O5S2/c1-2-3-11-22-30(27,28)19-6-4-5-14-12-17(13-18(24)20(14)19)29(25,26)23-16-9-7-15(21)8-10-16/h4-10,12-13,22-24H,2-3,11H2,1H3 |
| InChIKey | IMRRSJBOOMBNRC-UHFFFAOYSA-N |
| Density | 1.451g/cm3 (Cal.) |
|---|---|
| Boiling point | 689.773°C at 760 mmHg (Cal.) |
| Flash point | 370.962°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Butyl-N'-(4-Chlorophenyl)-8-Hydroxynaphthalene-1,6-Disulfonamide |