|
CAS#: 75956-48-8 Product: 2-(2-Methylpropyl)Propanedioyl Dichloride No suppilers available for the product. |
| Name | 2-(2-Methylpropyl)Propanedioyl Dichloride |
|---|---|
| Synonyms | 2-Isobutylpropanedioyl Dichloride; 2-Isobutylmalonyl Dichloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10Cl2O2 |
| Molecular Weight | 197.06 |
| CAS Registry Number | 75956-48-8 |
| EINECS | 278-350-0 |
| SMILES | C(C(C)C)C(C(Cl)=O)C(Cl)=O |
| InChI | 1S/C7H10Cl2O2/c1-4(2)3-5(6(8)10)7(9)11/h4-5H,3H2,1-2H3 |
| InChIKey | KZDYLDNWCHKFLN-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 213.243°C at 760 mmHg (Cal.) |
| Flash point | 89.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Methylpropyl)Propanedioyl Dichloride |