|
CAS#: 7596-29-4 Product: N-(Ethylideneamino)-4-Nitro-Aniline No suppilers available for the product. |
| Name | N-(Ethylideneamino)-4-Nitro-Aniline |
|---|---|
| Synonyms | N-(Ethylideneamino)-4-Nitro-Aniline; (Ethylideneamino)-(4-Nitrophenyl)Amine; Nsc405990 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 |
| CAS Registry Number | 7596-29-4 |
| SMILES | C1=C(C=CC(=C1)[N+]([O-])=O)N\N=C\C |
| InChI | 1S/C8H9N3O2/c1-2-9-10-7-3-5-8(6-4-7)11(12)13/h2-6,10H,1H3/b9-2+ |
| InChIKey | YVDNNYWGYXGGCI-XNWCZRBMSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.939°C at 760 mmHg (Cal.) |
| Flash point | 151.528°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Ethylideneamino)-4-Nitro-Aniline |