|
CAS#: 75965-77-4 Product: 5-Chloro-2-Nitrobenzo[g][1]Benzoxole No suppilers available for the product. |
| Name | 5-Chloro-2-Nitrobenzo[g][1]Benzoxole |
|---|---|
| Synonyms | 5-Chloro-2-Nitro-Benzo[G]Benzofuran; 5-Chloro-2-Nitrobenzo[G]Benzofuran; 5-Chloro-2-Nitro-Benzo[G][1]Benzoxole |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6ClNO3 |
| Molecular Weight | 247.64 |
| CAS Registry Number | 75965-77-4 |
| SMILES | C1=CC=CC2=C(C=C3C(=C12)OC(=C3)[N+](=O)[O-])Cl |
| InChI | 1S/C12H6ClNO3/c13-10-5-7-6-11(14(15)16)17-12(7)9-4-2-1-3-8(9)10/h1-6H |
| InChIKey | WVCSZHKCUSISON-UHFFFAOYSA-N |
| Density | 1.508g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.585°C at 760 mmHg (Cal.) |
| Flash point | 205.744°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-Nitrobenzo[g][1]Benzoxole |