|
CAS#: 7597-48-0 Product: Methyl 2-Acetamido-3-[(4-Nitrophenyl)Methylsulfonyl]Propanoate No suppilers available for the product. |
| Name | Methyl 2-Acetamido-3-[(4-Nitrophenyl)Methylsulfonyl]Propanoate |
|---|---|
| Synonyms | 2-Acetamido-3-[(4-Nitrophenyl)Methylsulfonyl]Propanoic Acid Methyl Ester; 2-Acetamido-3-(4-Nitrobenzyl)Sulfonyl-Propionic Acid Methyl Ester; Nsc56882 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2O7S |
| Molecular Weight | 344.34 |
| CAS Registry Number | 7597-48-0 |
| SMILES | C1=CC(=CC=C1C[S](=O)(=O)CC(NC(C)=O)C(=O)OC)[N+]([O-])=O |
| InChI | 1S/C13H16N2O7S/c1-9(16)14-12(13(17)22-2)8-23(20,21)7-10-3-5-11(6-4-10)15(18)19/h3-6,12H,7-8H2,1-2H3,(H,14,16) |
| InChIKey | XQOGZFVXVSDBIT-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 659.291°C at 760 mmHg (Cal.) |
| Flash point | 352.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Acetamido-3-[(4-Nitrophenyl)Methylsulfonyl]Propanoate |