|
CAS#: 762293-09-4 Product: 3-Amino-2,2-difluoro-3-phenylpropanamide No suppilers available for the product. |
| Name | 3-Amino-2,2-difluoro-3-phenylpropanamide |
|---|---|
| Synonyms | 3-Amino-2,2-difluor-3-phenylpropanamid; 3-Amino-2,2-difluoro-3-phenylpropanamide; 3-Amino-2,2-difluoro-3-phénylpropanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 |
| CAS Registry Number | 762293-09-4 |
| SMILES | c1ccc(cc1)C(C(C(=O)N)(F)F)N |
| InChI | 1S/C9H10F2N2O/c10-9(11,8(13)14)7(12)6-4-2-1-3-5-6/h1-5,7H,12H2,(H2,13,14) |
| InChIKey | RXVLKRSFTWMZAF-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.1±42.0°C at 760 mmHg (Cal.) |
| Flash point | 195.2±27.9°C (Cal.) |
| Refractive index | 1.53 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-2,2-difluoro-3-phenylpropanamide |