|
CAS#: 76391-90-7 Product: 1,3,4,5,5,5a,5b,6-Octachlorooctahydro-1,3,4-Metheno-2H-Cyclobuta(cd)Pentalen-2-One No suppilers available for the product. |
| Name | 1,3,4,5,5,5a,5b,6-Octachlorooctahydro-1,3,4-Metheno-2H-Cyclobuta(cd)Pentalen-2-One |
|---|---|
| Synonyms | Dihydrokepone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H2Cl8O |
| Molecular Weight | 421.75 |
| CAS Registry Number | 76391-90-7 |
| SMILES | O=C4C1(Cl)C2(Cl)C5(Cl)C3(Cl)C(Cl)(C1C2(Cl)C3(Cl)Cl)C45 |
| InChI | 1S/C10H2Cl8O/c11-4-1-2(19)5(12)3(4)7(14)8(5,15)6(1,13)9(4,16)10(7,17)18/h1,3H |
| InChIKey | ZAXAOUPBCRMFEJ-UHFFFAOYSA-N |
| Density | 2.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.686°C at 760 mmHg (Cal.) |
| Flash point | 187.426°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,4,5,5,5a,5b,6-Octachlorooctahydro-1,3,4-Metheno-2H-Cyclobuta(cd)Pentalen-2-One |