| Name | 3-Methyl-2H-1,4-Benzoxazin-2-One |
|---|---|
| Synonyms | Brn 1073158; 2H-1,4-Benzoxazin-2-One, 3-Methyl-; 3-Methyl-2H-1,4-Benzoxazin-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 7653-60-3 |
| SMILES | C1=CC=CC2=C1OC(=O)C(=N2)C |
| InChI | 1S/C9H7NO2/c1-6-9(11)12-8-5-3-2-4-7(8)10-6/h2-5H,1H3 |
| InChIKey | PEEMVDRTQBESEN-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.471°C at 760 mmHg (Cal.) |
| Flash point | 144.745°C (Cal.) |
| (1) | Mondelli R. Tautomerism in side-chain derivatives of n-heterocycles NMR and UV spectra—I, Tetrahedron, 1966 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2H-1,4-Benzoxazin-2-One |