|
CAS#: 7657-50-3 Product: 5alpha-Androstan-3alpha-Ol No suppilers available for the product. |
| Name | 5alpha-Androstan-3alpha-Ol |
|---|---|
| Synonyms | 5Alpha-Androstan-3Alpha-Ol; C15638; Spectrum5_002031 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 |
| CAS Registry Number | 7657-50-3 |
| SMILES | [C@H]13[C@@H]([C@@]2([C@@H](CC1)C[C@H](O)CC2)C)CC[C@]4([C@H]3CCC4)C |
| InChI | 1S/C19H32O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h13-17,20H,3-12H2,1-2H3/t13-,14+,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | DJTOLSNIKJIDFF-PHFHYRSDSA-N |
| Density | 1.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.913°C at 760 mmHg (Cal.) |
| Flash point | 158.43°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5alpha-Androstan-3alpha-Ol |