|
CAS#: 76617-38-4 Product: 3,3-Dichloro-5-Phenyloxolan-2-One No suppilers available for the product. |
| Name | 3,3-Dichloro-5-Phenyloxolan-2-One |
|---|---|
| Synonyms | 3,3-Dichloro-5-Phenyl-Tetrahydrofuran-2-One; 3,3-Dichloro-5-Phenyl-2-Tetrahydrofuranone; 3,3-Dichloro-5-Phenyl-Oxolan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8Cl2O2 |
| Molecular Weight | 231.08 |
| CAS Registry Number | 76617-38-4 |
| EINECS | 278-500-5 |
| SMILES | C2=C(C1OC(=O)C(Cl)(Cl)C1)C=CC=C2 |
| InChI | 1S/C10H8Cl2O2/c11-10(12)6-8(14-9(10)13)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | DHPZQCISEMBVQN-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.206°C at 760 mmHg (Cal.) |
| Flash point | 170.026°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dichloro-5-Phenyloxolan-2-One |