|
CAS#: 76625-78-0 Product: 1-Phenylethenyl Phosphate No suppilers available for the product. |
| Name | 1-Phenylethenyl Phosphate |
|---|---|
| Synonyms | 1-Phenylvinyl Phosphate; 1-Phenylvinyl Phosphate, Disodium Salt; Benzenemethanol, Alpha-Methylene-, Dihydrogen Phosphate, Disodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7O4P |
| Molecular Weight | 198.11 |
| CAS Registry Number | 76625-78-0 |
| SMILES | C1=C(C(O[P]([O-])([O-])=O)=C)C=CC=C1 |
| InChI | 1S/C8H9O4P/c1-7(12-13(9,10)11)8-5-3-2-4-6-8/h2-6H,1H2,(H2,9,10,11)/p-2 |
| InChIKey | AAGAISPOTYWQIV-UHFFFAOYSA-L |
| Boiling point | 394.163°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenylethenyl Phosphate |