Online Database of Chemicals from Around the World
|
CAS#: 76643-49-7 Product: 4,5-Diamino-1,8-Dihydroxy-2,7-Bis(2-Methylpropyl)Anthracene-9,10-Dione No suppilers available for the product. |
| Name | 4,5-Diamino-1,8-Dihydroxy-2,7-Bis(2-Methylpropyl)Anthracene-9,10-Dione |
|---|---|
| Synonyms | 4,5-Diamino-1,8-Dihydroxy-2,7-Diisobutyl-Anthracene-9,10-Dione; 4,5-Diamino-1,8-Dihydroxy-2,7-Diisobutylanthracene-9,10-Dione; 4,5-Diamino-1,8-Dihydroxy-2,7-Diisobutyl-9,10-Anthraquinone |
| Molecular Structure |  |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 |
| CAS Registry Number | 76643-49-7 |
| EINECS | 278-507-3 |
| SMILES | C3=C(N)C2=C(C(=O)C1=C(O)C(=CC(=C1C2=O)N)CC(C)C)C(=C3CC(C)C)O |
| InChI | 1S/C22H26N2O4/c1-9(2)5-11-7-13(23)15-17(19(11)25)22(28)18-16(21(15)27)14(24)8-12(20(18)26)6-10(3)4/h7-10,25-26H,5-6,23-24H2,1-4H3 |
| InChIKey | CZJZMSRDRZJNSB-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 665.818°C at 760 mmHg (Cal.) |
| Flash point | 356.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Diamino-1,8-Dihydroxy-2,7-Bis(2-Methylpropyl)Anthracene-9,10-Dione |