|
CAS#: 76691-49-1 Product: N-(4-Nitrophenyl)Undec-10-Enamide No suppilers available for the product. |
| Name | N-(4-Nitrophenyl)Undec-10-Enamide |
|---|---|
| Synonyms | P-Nitrophenylundecylenanilide; 10-Undecenamide, N-(4-Nitrophenyl)-; Brn 2754403 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 |
| CAS Registry Number | 76691-49-1 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)NC(=O)CCCCCCCCC=C |
| InChI | 1S/C17H24N2O3/c1-2-3-4-5-6-7-8-9-10-17(20)18-15-11-13-16(14-12-15)19(21)22/h2,11-14H,1,3-10H2,(H,18,20) |
| InChIKey | KUMYSKHGAQHCMQ-UHFFFAOYSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.247°C at 760 mmHg (Cal.) |
| Flash point | 253.316°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Nitrophenyl)Undec-10-Enamide |