|
CAS#: 76698-72-1 Product: 1-Methyl-4-[(4-Methylphenyl)Methylselanylmethyl]Benzene No suppilers available for the product. |
| Name | 1-Methyl-4-[(4-Methylphenyl)Methylselanylmethyl]Benzene |
|---|---|
| Synonyms | 1-Methyl-4-[[(4-Methylphenyl)Methylseleno]Methyl]Benzene; 1-Methyl-4-[[(4-Methylbenzyl)Seleno]Methyl]Benzene; Selenide, Bis(4-Methylbenzyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18Se |
| Molecular Weight | 289.28 |
| CAS Registry Number | 76698-72-1 |
| SMILES | C1=CC(=CC=C1C[Se]CC2=CC=C(C=C2)C)C |
| InChI | 1S/C16H18Se/c1-13-3-7-15(8-4-13)11-17-12-16-9-5-14(2)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | LBZYOLMZQHUANF-UHFFFAOYSA-N |
| Boiling point | 393.272°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 191.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-[(4-Methylphenyl)Methylselanylmethyl]Benzene |