Online Database of Chemicals from Around the World
|
CAS#: 76713-90-1 Product: (Z)-1-(4-Chlorophenyl)-4,4-Dimethyl-2-(1,2,4-Triazol-1-Yl)Pent-1-En-3-Ol No suppilers available for the product. |
| Name | (Z)-1-(4-Chlorophenyl)-4,4-Dimethyl-2-(1,2,4-Triazol-1-Yl)Pent-1-En-3-Ol |
|---|---|
| Synonyms | 1H-1,2,4-Triazole-1-Ethanol, Beta-((4-Chlorophenyl)Methylene)-Alpha-(1,1-Dimethylethyl)-, (Z)- |
| Molecular Structure |  |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 |
| CAS Registry Number | 76713-90-1 |
| SMILES | C1=NC=N[N]1C(/C(O)C(C)(C)C)=C\C2=CC=C(Cl)C=C2 |
| InChI | 1S/C15H18ClN3O/c1-15(2,3)14(20)13(19-10-17-9-18-19)8-11-4-6-12(16)7-5-11/h4-10,14,20H,1-3H3/b13-8- |
| InChIKey | YNWVFADWVLCOPU-JYRVWZFOSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.586°C at 760 mmHg (Cal.) |
| Flash point | 240.821°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-1-(4-Chlorophenyl)-4,4-Dimethyl-2-(1,2,4-Triazol-1-Yl)Pent-1-En-3-Ol |