|
CAS#: 76748-72-6 Product: Aspirin Phenylalanine Ethyl Ester No suppilers available for the product. |
| Name | Aspirin Phenylalanine Ethyl Ester |
|---|---|
| Synonyms | Ethyl (2S)-2-[(2-Acetoxybenzoyl)Amino]-3-Phenyl-Propanoate; (2S)-2-[[(2-Acetoxyphenyl)-Oxomethyl]Amino]-3-Phenylpropanoic Acid Ethyl Ester; (2S)-2-[(2-Acetoxybenzoyl)Amino]-3-Phenyl-Propionic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 |
| CAS Registry Number | 76748-72-6 |
| SMILES | [C@H](C(=O)OCC)(NC(C1=CC=CC=C1OC(=O)C)=O)CC2=CC=CC=C2 |
| InChI | 1S/C20H21NO5/c1-3-25-20(24)17(13-15-9-5-4-6-10-15)21-19(23)16-11-7-8-12-18(16)26-14(2)22/h4-12,17H,3,13H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | KMAAFJXQASELNT-KRWDZBQOSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.036°C at 760 mmHg (Cal.) |
| Flash point | 278.59°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aspirin Phenylalanine Ethyl Ester |