| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Cysteine derivative |
|---|---|
| Name | N-Cyclohexylcyclohexanaminium (2R)-3-(benzylsulfanyl)-2-{[(2-nitrophenyl)sulfanyl]amino}propanoate |
| Synonyms | N-(2-Nitr |
| Molecular Structure | ![]() |
| Molecular Formula | C28H39N3O4S2 |
| Molecular Weight | 545.76 |
| CAS Registry Number | 7675-65-2 |
| SMILES | c1ccc(cc1)CSC[C@@H](C(=O)[O-])NSc2ccccc2[N+](=O)[O-].C1CCC(CC1)[NH2+]C2CCCCC2 |
| InChI | 1S/C16H16N2O4S2.C12H23N/c19-16(20)13(11-23-10-12-6-2-1-3-7-12)17-24-15-9-5-4-8-14(15)18(21)22;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,13,17H,10-11H2,(H,19,20);11-13H,1-10H2/t13-;/m0./s1 |
| InChIKey | MAUIFYQGIWFDHJ-ZOWNYOTGSA-N |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Cyclohexylcyclohexanaminium (2R)-3-(benzylsulfanyl)-2-{[(2-nitrophenyl)sulfanyl]amino}propanoate |