|
CAS#: 76777-02-1 Product: 2-(Cyclopropylmethyl)-1,2,3,4,5,6-Hexahydro-1,6-Methano-2-Benzazocine Hydrochloride No suppilers available for the product. |
| Name | 2-(Cyclopropylmethyl)-1,2,3,4,5,6-Hexahydro-1,6-Methano-2-Benzazocine Hydrochloride |
|---|---|
| Synonyms | 2-(Cyclopropylmethyl)-1,2,3,4,5,6-Hexahydro-1,6-Methano-2-Benzazocine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 |
| CAS Registry Number | 76777-02-1 |
| SMILES | [H+].C3=C2C4N(CC1CC1)CCCC(C2=CC=C3)C4.[Cl-] |
| InChI | 1S/C16H21N.ClH/c1-2-6-15-14(5-1)13-4-3-9-17(16(15)10-13)11-12-7-8-12;/h1-2,5-6,12-13,16H,3-4,7-11H2;1H |
| InChIKey | SBZRLBZOFIOKRT-UHFFFAOYSA-N |
| Boiling point | 332°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 140.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Cyclopropylmethyl)-1,2,3,4,5,6-Hexahydro-1,6-Methano-2-Benzazocine Hydrochloride |