|
CAS#: 7682-65-7 Product: 6,7',12-Trimethoxy-2,2'-Dimethylthalman-6'-Ol No suppilers available for the product. |
| Name | 6,7',12-Trimethoxy-2,2'-Dimethylthalman-6'-Ol |
|---|---|
| Synonyms | C09659 |
| Molecular Structure | ![]() |
| Molecular Formula | C37H40N2O6 |
| Molecular Weight | 608.73 |
| CAS Registry Number | 7682-65-7 |
| SMILES | O4C1=C2C(=CC(=C1O)OC)[C@@H](N(CC2)C)CC7=CC=C(OC3=C(OC)C=CC(=C3)C[C@@H]5N(CCC6=CC(=C4C=C56)OC)C)C=C7 |
| InChI | 1S/C37H40N2O6/c1-38-14-12-24-19-32(42-4)34-20-27(24)29(38)17-23-8-11-31(41-3)33(18-23)44-25-9-6-22(7-10-25)16-30-28-21-35(43-5)36(40)37(45-34)26(28)13-15-39(30)2/h6-11,18-21,29-30,40H,12-17H2,1-5H3/t29-,30-/m0/s1 |
| InChIKey | CASHVZNATRNXDE-KYJUHHDHSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 726.996°C at 760 mmHg (Cal.) |
| Flash point | 393.473°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7',12-Trimethoxy-2,2'-Dimethylthalman-6'-Ol |