|
CAS#: 7694-30-6 Product: cis-1,2-Diphenylcyclobutane-D5 No suppilers available for the product. |
| Name | cis-1,2-Diphenylcyclobutane-D5 |
|---|---|
| Synonyms | 1,1'-(1,2-Cyclobutanediyl)Bisbenzene Cis-; Benzene, 1,1'-(1,2-Cyclobutanediyl)Bis-, Cis-; Cyclobutane, 1,2-Diphenyl-, Cis- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 7694-30-6 |
| SMILES | [C@H]2(C1=CC=CC=C1)CC[C@H]2C3=CC=CC=C3 |
| InChI | 1S/C16H16/c1-3-7-13(8-4-1)15-11-12-16(15)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/t15-,16+ |
| InChIKey | AERGGMDNGDDGPI-IYBDPMFKSA-N |
| Density | 1.045g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.063°C at 760 mmHg (Cal.) |
| Flash point | 145.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-1,2-Diphenylcyclobutane-D5 |