|
CAS#: 76980-25-1 Product: (2S)-2-[(2-Chloropyridine-3-Carbonyl)Amino]Pentanedioic Acid No suppilers available for the product. |
| Name | (2S)-2-[(2-Chloropyridine-3-Carbonyl)Amino]Pentanedioic Acid |
|---|---|
| Synonyms | (2S)-2-[[(2-Chloro-3-Pyridyl)-Oxomethyl]Amino]Pentanedioic Acid; (2S)-2-[(2-Chloropyridine-3-Carbonyl)Amino]Glutaric Acid; (2S)-2-[(2-Chloropyridin-3-Yl)Carbonylamino]Pentanedioic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11ClN2O5 |
| Molecular Weight | 286.67 |
| CAS Registry Number | 76980-25-1 |
| SMILES | [C@H](C(=O)O)(NC(=O)C1=CC=CN=C1Cl)CCC(=O)O |
| InChI | 1S/C11H11ClN2O5/c12-9-6(2-1-5-13-9)10(17)14-7(11(18)19)3-4-8(15)16/h1-2,5,7H,3-4H2,(H,14,17)(H,15,16)(H,18,19)/t7-/m0/s1 |
| InChIKey | YVSROHGWUQOQGM-ZETCQYMHSA-N |
| Density | 1.504g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.207°C at 760 mmHg (Cal.) |
| Flash point | 304.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-[(2-Chloropyridine-3-Carbonyl)Amino]Pentanedioic Acid |