|
CAS#: 77020-21-4 Product: Sodium S-benzyl O-isopropyl phosphorothioate No suppilers available for the product. |
| Name | Sodium S-benzyl O-isopropyl phosphorothioate |
|---|---|
| Synonyms | Phosphoro |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14NaO3PS |
| Molecular Weight | 268.24 |
| CAS Registry Number | 77020-21-4 |
| SMILES | [Na+].[O-]P(=O)(SCc1ccccc1)OC(C)C |
| InChI | 1S/C10H15O3PS.Na/c1-9(2)13-14(11,12)15-8-10-6-4-3-5-7-10;/h3-7,9H,8H2,1-2H3,(H,11,12);/q;+1/p-1 |
| InChIKey | WEMQVNPYOCLWPZ-UHFFFAOYSA-M |
| Boiling point | 364.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium S-benzyl O-isopropyl phosphorothioate |