|
CAS#: 77061-07-5 Product: 7-(Bromomethyl)Fluoranthene No suppilers available for the product. |
| Name | 7-(Bromomethyl)Fluoranthene |
|---|---|
| Synonyms | 7-Bromomethylfluoranthene; Ccris 5206 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H11Br |
| Molecular Weight | 295.18 |
| CAS Registry Number | 77061-07-5 |
| SMILES | C3=C1C4=C(C2=CC=CC(=C12)C=C3)C(=CC=C4)CBr |
| InChI | 1S/C17H11Br/c18-10-12-6-3-8-14-13-7-1-4-11-5-2-9-15(16(11)13)17(12)14/h1-9H,10H2 |
| InChIKey | DGQZUDLURVDACO-UHFFFAOYSA-N |
| Density | 1.542g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.316°C at 760 mmHg (Cal.) |
| Flash point | 225.477°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(Bromomethyl)Fluoranthene |