|
CAS#: 77071-04-6 Product: 8-(4-Bromophenyl)-7H-Purin-6-Amine No suppilers available for the product. |
| Name | 8-(4-Bromophenyl)-7H-Purin-6-Amine |
|---|---|
| Synonyms | [8-(4-Bromophenyl)-7H-Purin-6-Yl]Amine; Nsc314092 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8BrN5 |
| Molecular Weight | 290.12 |
| CAS Registry Number | 77071-04-6 |
| SMILES | C1=NC2=C(C(=N1)N)[NH]C(=N2)C3=CC=C(C=C3)Br |
| InChI | 1S/C11H8BrN5/c12-7-3-1-6(2-4-7)10-16-8-9(13)14-5-15-11(8)17-10/h1-5H,(H3,13,14,15,16,17) |
| InChIKey | FAZDSEAMEPELHB-UHFFFAOYSA-N |
| Density | 1.755g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.785°C at 760 mmHg (Cal.) |
| Flash point | 279.647°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-(4-Bromophenyl)-7H-Purin-6-Amine |