|
CAS#: 77084-33-4 Product: Methyl 9-Oxothioxanthene-1-Carboxylate No suppilers available for the product. |
| Name | Methyl 9-Oxothioxanthene-1-Carboxylate |
|---|---|
| Synonyms | 9-Oxo-1-Thioxanthenecarboxylic Acid Methyl Ester; 9-Ketothioxanthene-1-Carboxylic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10O3S |
| Molecular Weight | 270.30 |
| CAS Registry Number | 77084-33-4 |
| EINECS | 278-605-6 |
| SMILES | C1=CC=C(C(OC)=O)C2=C1SC3=C(C2=O)C=CC=C3 |
| InChI | 1S/C15H10O3S/c1-18-15(17)10-6-4-8-12-13(10)14(16)9-5-2-3-7-11(9)19-12/h2-8H,1H3 |
| InChIKey | MLCOFATYVJHBED-UHFFFAOYSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.5°C at 760 mmHg (Cal.) |
| Flash point | 236.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 9-Oxothioxanthene-1-Carboxylate |