|
CAS#: 77092-19-4 Product: 2,6-Bis(4-Methoxyphenyl)-2-Methyl-1,3-Dioxin-4-One No suppilers available for the product. |
| Name | 2,6-Bis(4-Methoxyphenyl)-2-Methyl-1,3-Dioxin-4-One |
|---|---|
| Synonyms | 4H-1,3-Dioxin-4-One, 2,6-Bis(4-Methoxyphenyl)-2-Methyl-; 2,6-Bis(4-Methoxyphenyl)-2-Methyl-4H-1,3-Dioxin-4-One; 2-Methyl-2,6-Di-P-Methoxyphenyl-1,3-Dioxine-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 |
| CAS Registry Number | 77092-19-4 |
| SMILES | C1=CC(=CC=C1C2=CC(OC(O2)(C)C3=CC=C(C=C3)OC)=O)OC |
| InChI | 1S/C19H18O5/c1-19(14-6-10-16(22-3)11-7-14)23-17(12-18(20)24-19)13-4-8-15(21-2)9-5-13/h4-12H,1-3H3 |
| InChIKey | QKNONWGRWUKPIP-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.524°C at 760 mmHg (Cal.) |
| Flash point | 225.607°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Bis(4-Methoxyphenyl)-2-Methyl-1,3-Dioxin-4-One |