|
CAS#: 77119-37-0 Product: Naphthalen-2-Ylmethyl Prop-2-Ynoate No suppilers available for the product. |
| Name | Naphthalen-2-Ylmethyl Prop-2-Ynoate |
|---|---|
| Synonyms | 2-Naphthylmethyl Prop-2-Ynoate; Prop-2-Ynoic Acid 2-Naphthylmethyl Ester; Propiolic Acid 2-Naphthylmethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 77119-37-0 |
| SMILES | C1=C2C(=CC=C1COC(C#C)=O)C=CC=C2 |
| InChI | 1S/C14H10O2/c1-2-14(15)16-10-11-7-8-12-5-3-4-6-13(12)9-11/h1,3-9H,10H2 |
| InChIKey | RTAQUFTZZDBSMN-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Naphthalen-2-Ylmethyl Prop-2-Ynoate |