Online Database of Chemicals from Around the World
|
CAS#: 77123-17-2 Product: (3R,4R)-3,4-Dihydrophenanthrene-3,4-Diol No suppilers available for the product. |
| Name | (3R,4R)-3,4-Dihydrophenanthrene-3,4-Diol |
|---|---|
| Synonyms | 3,4-Phenanthrenediol, 3,4-Dihydro-, (3R-Trans)-; Chebi:37468 |
| Molecular Structure |  |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 |
| CAS Registry Number | 77123-17-2 |
| SMILES | [C@@H]3(O)C1=C(C=CC2=C1C=CC=C2)C=C[C@H]3O |
| InChI | 1S/C14H12O2/c15-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)14(12)16/h1-8,12,14-16H/t12-,14+/m1/s1 |
| InChIKey | FOTICWSJABVKPW-OCCSQVGLSA-N |
| Density | 1.346g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.96°C at 760 mmHg (Cal.) |
| Flash point | 217.471°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R,4R)-3,4-Dihydrophenanthrene-3,4-Diol |