|
CAS#: 77139-82-3 Product: 2-(1-Adamantyl)-1-Methylimidazole No suppilers available for the product. |
| Name | 2-(1-Adamantyl)-1-Methylimidazole |
|---|---|
| Synonyms | 2-(1-Adamantyl)-1-Methyl-Imidazole; 1H-Imidazole, 1-Methyl-2-Tricyclo(3.3.1.13,7)Dec-1-Yl-; Imidazole, 2-(1-Adamantyl)-1-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 |
| CAS Registry Number | 77139-82-3 |
| SMILES | C1=C[N](C(=N1)C34CC2CC(CC(C2)C3)C4)C |
| InChI | 1S/C14H20N2/c1-16-3-2-15-13(16)14-7-10-4-11(8-14)6-12(5-10)9-14/h2-3,10-12H,4-9H2,1H3 |
| InChIKey | CBRRJMLAAUIMIX-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.5°C at 760 mmHg (Cal.) |
| Flash point | 176.663°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Adamantyl)-1-Methylimidazole |