|
CAS#: 772292-33-8 Product: 9-Amino-2,3,7,8,9,9a-hexahydro-1H-phenalene-4,5-diol No suppilers available for the product. |
| Name | 9-Amino-2,3,7,8,9,9a-hexahydro-1H-phenalene-4,5-diol |
|---|---|
| Synonyms | 1H-Phenalene-4,5-diol, 9-amino-2,3,7,8,9,9a-hexahydro-; 1H-PHENAL |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 772292-33-8 |
| SMILES | c1c2c3c(c(c1O)O)CCCC3C(CC2)N |
| InChI | 1S/C13H17NO2/c14-10-5-4-7-6-11(15)13(16)9-3-1-2-8(10)12(7)9/h6,8,10,15-16H,1-5,14H2 |
| InChIKey | HIBLEXFOYWGUER-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 203.2±28.7°C (Cal.) |
| Refractive index | 1.644 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Amino-2,3,7,8,9,9a-hexahydro-1H-phenalene-4,5-diol |