|
CAS#: 7735-65-1 Product: 4,6-Dimethyl-5-Hydroxy-1,3-Benzoxathiol-2-One No suppilers available for the product. |
| Name | 4,6-Dimethyl-5-Hydroxy-1,3-Benzoxathiol-2-One |
|---|---|
| Synonyms | 1,3-Benzoxathiol-2-One, 4,6-Dimethyl-5-Hydroxy-; 1,3-Benzoxathiol-2-One, 4,6-Dimethyl-5-Hydroxy-, |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.22 |
| CAS Registry Number | 7735-65-1 |
| SMILES | C1=C(C(=C(C2=C1OC(S2)=O)C)O)C |
| InChI | 1S/C9H8O3S/c1-4-3-6-8(5(2)7(4)10)13-9(11)12-6/h3,10H,1-2H3 |
| InChIKey | OONAXBHQRHBAAP-UHFFFAOYSA-N |
| Density | 1.437g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.99°C at 760 mmHg (Cal.) |
| Flash point | 170.912°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethyl-5-Hydroxy-1,3-Benzoxathiol-2-One |