|
CAS#: 7739-63-1 Product: Potassium Decyl Sulphate No suppilers available for the product. |
| Name | Potassium Decyl Sulphate |
|---|---|
| Synonyms | Potassium Decyl Sulphate; Sulfuric Acid, Monodecyl Ester, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C10H21KO4S |
| Molecular Weight | 276.43 |
| CAS Registry Number | 7739-63-1 |
| EINECS | 231-803-6 |
| SMILES | C(O[S]([O-])(=O)=O)CCCCCCCCC.[K+] |
| InChI | 1S/C10H22O4S.K/c1-2-3-4-5-6-7-8-9-10-14-15(11,12)13;/h2-10H2,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | JTXIPOLAHSBNJM-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Potassium Decyl Sulphate |