|
CAS#: 77529-12-5 Product: N-[(2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methyl]Propan-2-Amine Hydrochloride No suppilers available for the product. |
| Name | N-[(2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methyl]Propan-2-Amine Hydrochloride |
|---|---|
| Synonyms | Isopropyl-[(2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methyl]Amine Hydrochloride; Methyl-2 (N-Isopropylaminomethyl)-5 Tetrahydro-4,5,6,7-Benzo(D)Thiazole Chlorhydrate [French]; 4,5,6,7-Tetrahydro-2-Methyl-N-(1-Methylethyl)-5-Benzothiazolemethanamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H21ClN2S |
| Molecular Weight | 260.82 |
| CAS Registry Number | 77529-12-5 |
| SMILES | [H+].C(NC(C)C)C2CC1=C(SC(=N1)C)CC2.[Cl-] |
| InChI | 1S/C12H20N2S.ClH/c1-8(2)13-7-10-4-5-12-11(6-10)14-9(3)15-12;/h8,10,13H,4-7H2,1-3H3;1H |
| InChIKey | ASITZMVPVWKRNR-UHFFFAOYSA-N |
| Boiling point | 328.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 152.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methyl]Propan-2-Amine Hydrochloride |