|
CAS#: 77529-41-0 Product: 5-Hydroxy-4-(4-Phenylphenyl)-1H-Pyrrole-2,3-Dione No suppilers available for the product. |
| Name | 5-Hydroxy-4-(4-Phenylphenyl)-1H-Pyrrole-2,3-Dione |
|---|---|
| Synonyms | 5-Hydroxy-4-(4-Phenylphenyl)-2-Pyrroline-2,3-Quinone; 3-(1,1'-Biphenyl)-4-Yl-4-Hydroxy-1H-Pyrrole-2,5-Dione; Brn 4458688 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 |
| CAS Registry Number | 77529-41-0 |
| SMILES | C2=C(C1=C(O)NC(=O)C1=O)C=CC(=C2)C3=CC=CC=C3 |
| InChI | 1S/C16H11NO3/c18-14-13(15(19)17-16(14)20)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H2,17,18,19,20) |
| InChIKey | JOHXXIIKYZCYCN-UHFFFAOYSA-N |
| Density | 1.371g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.5°C at 760 mmHg (Cal.) |
| Flash point | 249.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Hydroxy-4-(4-Phenylphenyl)-1H-Pyrrole-2,3-Dione |