|
CAS#: 77602-69-8 Product: (E)-2-Chloro-3-hydroxy-9-(3-dimethylaminopropylidene)thioxanthene hydrogen maleate No suppilers available for the product. |
| Name | (E)-2-Chloro-3-hydroxy-9-(3-dimethylaminopropylidene)thioxanthene hydrogen maleate |
|---|---|
| Synonyms | But-2-Enedioic Acid; (9E)-2-Chloro-9-(3-Dimethylaminopropylidene)-3-Thioxanthenol; (E)-2-Chloro-3-Hydroxy-9-(3-Dimethylaminopropylidene)Thioxanthene Hydrogen Maleate; (E)-3-Hydroxychlorprothixene Hydrogen Maleate |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22ClNO5S |
| Molecular Weight | 447.93 |
| CAS Registry Number | 77602-69-8 |
| SMILES | C1=C(Cl)C(=CC2=C1\C(C3=C(S2)C=CC=C3)=C\CCN(C)C)O.O=C(O)\C=C/C(=O)O |
| InChI | 1S/C18H18ClNOS.C4H4O4/c1-20(2)9-5-7-12-13-6-3-4-8-17(13)22-18-11-16(21)15(19)10-14(12)18;5-3(6)1-2-4(7)8/h3-4,6-8,10-11,21H,5,9H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b12-7+;2-1- |
| InChIKey | SOAOYLHIAWNDRO-LTLNIHEKSA-N |
| Boiling point | 467.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 236.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-2-Chloro-3-hydroxy-9-(3-dimethylaminopropylidene)thioxanthene hydrogen maleate |