|
CAS#: 77628-62-7 Product: 1-(1,1,3-Trimethyl-2,3,3A,4,5,6-Hexahydroinden-5-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(1,1,3-Trimethyl-2,3,3A,4,5,6-Hexahydroinden-5-Yl)Ethanone |
|---|---|
| Synonyms | 1-(2,3,3A,4,5,6-Hexahydro-1,1,3-Trimethyl-1H-Inden-5-Yl)Ethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 77628-62-7 |
| EINECS | 278-734-8 |
| SMILES | CC2(C1=CCC(CC1C(C2)C)C(=O)C)C |
| InChI | 1S/C14H22O/c1-9-8-14(3,4)13-6-5-11(10(2)15)7-12(9)13/h6,9,11-12H,5,7-8H2,1-4H3 |
| InChIKey | WXBXKFWYTYPIGQ-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.204°C at 760 mmHg (Cal.) |
| Flash point | 115.856°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,1,3-Trimethyl-2,3,3A,4,5,6-Hexahydroinden-5-Yl)Ethanone |